CAS 6962-09-0
:3-(4-hydroxyphenyl)-2-phenylprop-2-enoic acid
Description:
3-(4-Hydroxyphenyl)-2-phenylprop-2-enoic acid, also known as 4-Hydroxychalcone, is an organic compound characterized by its phenolic structure and conjugated double bond system. It features a central prop-2-enoic acid moiety with hydroxyl and phenyl substituents, contributing to its potential biological activity. This compound typically exhibits properties such as antioxidant activity, which is attributed to the presence of the hydroxyl group that can donate hydrogen atoms to free radicals. Additionally, it may possess anti-inflammatory and anti-cancer properties, making it of interest in pharmaceutical research. The compound is generally soluble in organic solvents and may have limited solubility in water due to its hydrophobic phenyl groups. Its molecular structure allows for various chemical reactions, including esterification and oxidation, which can be utilized in synthetic organic chemistry. Overall, 3-(4-hydroxyphenyl)-2-phenylprop-2-enoic acid is a significant compound in the study of natural products and medicinal chemistry.
Formula:C15H12O3
InChI:InChI=1/C15H12O3/c16-13-8-6-11(7-9-13)10-14(15(17)18)12-4-2-1-3-5-12/h1-10,16H,(H,17,18)
SMILES:c1ccc(cc1)C(=Cc1ccc(cc1)O)C(=O)O
Synonyms:- p-Hydroxy-alpha-phenylcinnamic acid
- 3-(4-Hydroxyphenyl)-2-phenyl-2-propenoic acid
- alpha-Phenyl-p-hydroxycinnamic acid
- NSC 35619
- GAXUWNPJYOWVDR-UHFFFAOYSA-N
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.