CAS 7460-03-9

disodium (11beta,16beta)-9-fluoro-21-hydroxy-16-methyl-3,20-dioxopregna-1,4-diene-11,17-diolate

Description:

Disodium (11beta,16beta)-9-fluoro-21-hydroxy-16-methyl-3,20-dioxopregna-1,4-diene-11,17-diolate, commonly known as a synthetic corticosteroid, is characterized by its complex steroid structure, which includes a fluorine atom and multiple hydroxyl groups that contribute to its biological activity. This compound is typically used for its anti-inflammatory and immunosuppressive properties, making it valuable in treating various conditions such as allergies, asthma, and autoimmune disorders. The presence of the dioxo and diolate functional groups enhances its solubility and bioavailability. As a disodium salt, it is formulated to improve stability and facilitate administration. The compound's mechanism of action involves binding to glucocorticoid receptors, leading to the modulation of gene expression and subsequent physiological effects. Its pharmacokinetics, including absorption, distribution, metabolism, and excretion, are influenced by its chemical structure, which allows for effective therapeutic applications while minimizing side effects when used appropriately.

Formula: C₂₂H₂₇FNa₂O₅

InChI: InChI=1/C22H27FO5.2Na/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24;;/h6-7,9,12,15-17,24H,4-5,8,10-11H2,1-3H3;;/q-2;2*+1/t12-,15-,16-,17-,19-,20-,21-,22-;;/m0../s1

SMILES: CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(C(CC2(C)C1(C(=O)CO)[O-])[O-])F.[Na].[Na]