CAS 773134-85-3
:Ethyl 3-bromo-5-chloro-2-hydroxybenzoate
Description:
Ethyl 3-bromo-5-chloro-2-hydroxybenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. This compound features a benzene ring substituted with a hydroxyl group (–OH), a bromo group (–Br), and a chloro group (–Cl), indicating its potential reactivity and biological activity. The presence of these halogen substituents can influence the compound's solubility, stability, and interaction with biological systems. Ethyl 3-bromo-5-chloro-2-hydroxybenzoate is likely to exhibit moderate polarity due to the hydroxyl group, which can engage in hydrogen bonding. Its structural features suggest potential applications in pharmaceuticals or agrochemicals, as halogenated compounds often possess unique properties that can enhance biological activity. Additionally, the compound's synthesis and handling require careful consideration of safety protocols due to the presence of halogens, which can be hazardous. Overall, this compound represents a class of halogenated aromatic esters with diverse applications in chemical research and industry.
Formula:C9H8BrClO3
InChI:InChI=1S/C9H8BrClO3/c1-2-14-9(13)6-3-5(11)4-7(10)8(6)12/h3-4,12H,2H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
