CymitQuimica logo

CAS 79438-97-4

:

3,5,12-trihydroxy-10-methoxy-6,11-dioxo-3-(2-oxopropyl)-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-amino-2,3,6-trideoxyhexopyranoside

Description:
3,5,12-Trihydroxy-10-methoxy-6,11-dioxo-3-(2-oxopropyl)-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-amino-2,3,6-trideoxyhexopyranoside, with the CAS number 79438-97-4, is a complex organic compound characterized by its polycyclic structure and multiple functional groups. This substance features a tetracene backbone, which is a fused ring system known for its stability and potential electronic properties. The presence of hydroxyl groups indicates it has significant polarity, which can influence its solubility and reactivity. The methoxy group contributes to its overall hydrophobic character, while the amino and trideoxyhexopyranoside moieties suggest potential biological activity, possibly related to interactions with biomolecules. The compound's dioxo groups imply it may participate in redox reactions. Overall, this compound's intricate structure and functional diversity suggest potential applications in pharmaceuticals or materials science, although specific biological or chemical properties would require further investigation through empirical studies.
Formula:C28H31NO10
InChI:InChI=1/C28H31NO10/c1-11(30)8-28(36)9-14-20(17(10-28)39-18-7-15(29)23(31)12(2)38-18)27(35)22-21(25(14)33)24(32)13-5-4-6-16(37-3)19(13)26(22)34/h4-6,12,15,17-18,23,31,33,35-36H,7-10,29H2,1-3H3
SMILES:CC(=O)CC1(Cc2c(C(C1)OC1CC(C(C(C)O1)O)N)c(c1c(C(=O)c3cccc(c3C1=O)OC)c2O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.