CAS 86383-21-3

1-[2-(3-amino-2-hydroxypropoxy)phenyl]-3-phenylpropan-1-one

Description:

1-[2-(3-amino-2-hydroxypropoxy)phenyl]-3-phenylpropan-1-one, with the CAS number 86383-21-3, is a chemical compound that features a complex structure characterized by the presence of a phenyl group and a propanone moiety. This compound contains an amino group and a hydroxyl group, which contribute to its potential as a bioactive molecule. The presence of these functional groups suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The compound's structure indicates it may interact with biological systems, potentially serving as a pharmacophore in medicinal chemistry. Its molecular weight, polarity, and specific stereochemistry would affect its biological activity and pharmacokinetics. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this substance may have applications in pharmaceuticals or as a research chemical, although specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₈H₂₁NO₃

InChI: InChI=1/C18H21NO3/c19-12-15(20)13-22-18-9-5-4-8-16(18)17(21)11-10-14-6-2-1-3-7-14/h1-9,15,20H,10-13,19H2

SMILES: c1ccc(cc1)CCC(=O)c1ccccc1OCC(CN)O

Synonyms:

• 1-(2-(3-Amino-2-hydroxypropoxy)phenyl)-3-phenyl-1-propanone
• 1-Propanone, 1-(2-(3-amino-2-hydroxypropoxy)phenyl)-3-phenyl-

N-Depropylpropafenone

CAS: 86383-21-3

N-Depropylpropafenone, an active metabolite of Propafenone, is produced through the metabolism by the CYP450 enzyme system (primarily CYP2D6). It functions by blocking sodium ion channels, thereby delaying the depolarization process in myocardial cells and exhibiting antiarrhythmic properties.

Formula: C₁₈H₂₁NO₃

Color and Shape: Solid

Molecular weight: 299.36

Ref: TM-T201563