CymitQuimica logo

CAS 87505-04-2

:

(3-chloro-2-hydroxy-propyl) heptadecanoate

Description:
(3-Chloro-2-hydroxy-propyl) heptadecanoate, with the CAS number 87505-04-2, is an ester derived from heptadecanoic acid and a chlorinated alcohol. This compound features a long hydrophobic carbon chain due to the heptadecanoate moiety, which contributes to its potential applications in surfactants, emulsifiers, or as a lubricant. The presence of the 3-chloro and 2-hydroxy groups introduces polar characteristics, enhancing its solubility in polar solvents and potentially increasing its reactivity in various chemical processes. The hydroxyl group can participate in hydrogen bonding, which may influence its physical properties, such as melting and boiling points, as well as its behavior in biological systems. Additionally, the chlorine atom may impart unique reactivity and stability characteristics, making it of interest in synthetic organic chemistry. Overall, this compound's structure suggests it could be useful in various industrial applications, although specific safety and handling guidelines should be followed due to the presence of chlorine and potential biological activity.
Formula:C20H39ClO3
InChI:InChI=1/C20H39ClO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(23)24-18-19(22)17-21/h19,22H,2-18H2,1H3
SMILES:CCCCCCCCCCCCCCCCC(=O)OCC(CCl)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.