CAS 898751-61-6
:ethyl 8-[2-(morpholinomethyl)phenyl]-8-oxo-octanoate
Description:
Ethyl 8-[2-(morpholinomethyl)phenyl]-8-oxo-octanoate, identified by its CAS number 898751-61-6, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester functional group, a ketone, and a morpholine moiety. This compound typically exhibits properties associated with both lipophilicity and hydrophilicity due to the presence of the ethyl ester and morpholine ring, making it potentially soluble in various organic solvents while also having some degree of water solubility. The morpholinomethyl group may impart biological activity, suggesting potential applications in pharmaceuticals or agrochemicals. Its oxo-octanoate backbone indicates that it may participate in various chemical reactions, including esterification and nucleophilic substitutions. The compound's molecular structure suggests it could interact with biological systems, possibly influencing enzyme activity or receptor binding, which warrants further investigation in medicinal chemistry contexts. Overall, ethyl 8-[2-(morpholinomethyl)phenyl]-8-oxo-octanoate represents a versatile chemical entity with potential applications in drug development and other fields.
Formula:C21H31NO4
InChI:InChI=1/C21H31NO4/c1-2-26-21(24)12-6-4-3-5-11-20(23)19-10-8-7-9-18(19)17-22-13-15-25-16-14-22/h7-10H,2-6,11-17H2,1H3
SMILES:CCOC(=O)CCCCCCC(=O)c1ccccc1CN1CCOCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.