CAS 898758-91-3
:ethyl 5-(4-methoxy-3-nitro-phenyl)-5-oxo-pentanoate
Description:
Ethyl 5-(4-methoxy-3-nitro-phenyl)-5-oxo-pentanoate, identified by its CAS number 898758-91-3, is an organic compound characterized by its ester functional group and a complex aromatic structure. This compound features a pentanoate backbone, which contributes to its ester properties, and a phenyl ring substituted with both a methoxy group and a nitro group, enhancing its reactivity and potential applications in organic synthesis. The presence of the nitro group typically imparts electrophilic characteristics, making it a candidate for further chemical transformations. Ethyl 5-(4-methoxy-3-nitro-phenyl)-5-oxo-pentanoate may exhibit moderate solubility in organic solvents, while its stability can be influenced by the substituents on the aromatic ring. This compound could be of interest in medicinal chemistry and materials science due to its unique structural features, which may allow for the development of novel pharmaceuticals or functional materials. As with many organic compounds, handling should be conducted with care, considering potential toxicity and environmental impact.
Formula:C14H17NO6
InChI:InChI=1/C14H17NO6/c1-3-21-14(17)6-4-5-12(16)10-7-8-13(20-2)11(9-10)15(18)19/h7-9H,3-6H2,1-2H3
SMILES:CCOC(=O)CCCC(=O)c1ccc(c(c1)N(=O)=O)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.