CymitQuimica logo

CAS 898759-32-5

:

2-ethyl-1-oxazol-2-yl-butan-1-one

Description:
2-Ethyl-1-oxazol-2-yl-butan-1-one is a chemical compound characterized by its unique structure, which includes an oxazole ring and a butanone moiety. The oxazole ring contributes to its heterocyclic nature, providing specific reactivity and stability under various conditions. This compound typically exhibits moderate polarity due to the presence of both hydrophobic (ethyl and butanone groups) and hydrophilic (oxazole) components. It may display interesting biological activities, making it of interest in pharmaceutical and agrochemical research. The presence of the butanone group suggests potential applications in organic synthesis and as a building block for more complex molecules. Additionally, its molecular structure may influence its solubility, melting point, and boiling point, which are critical for determining its practical applications. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks. Overall, 2-ethyl-1-oxazol-2-yl-butan-1-one represents a versatile compound with potential utility in various chemical and industrial applications.
Formula:C9H13NO2
InChI:InChI=1/C9H13NO2/c1-3-7(4-2)8(11)9-10-5-6-12-9/h5-7H,3-4H2,1-2H3
SMILES:CCC(CC)C(=O)c1ncco1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.