CymitQuimica logo

CAS 898762-78-2

:

(2-methoxyphenyl)-[3-(thiomorpholinomethyl)phenyl]methanone

Description:
(2-Methoxyphenyl)-[3-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898762-78-2, is a synthetic organic compound characterized by its complex structure, which includes a methoxy group and a thiomorpholine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the methoxy group enhances its electron-donating characteristics, which can influence its interaction with biological targets. The thiomorpholine ring introduces a heterocyclic element, potentially affecting the compound's pharmacokinetics and biological activity. Such compounds are often investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with specific biological pathways. Additionally, the structural features may confer unique properties such as stability, lipophilicity, and the ability to form hydrogen bonds, which are critical for drug design and efficacy. Overall, this compound represents a class of molecules with diverse applications in chemical and pharmaceutical research.
Formula:C19H21NO2S
InChI:InChI=1/C19H21NO2S/c1-22-18-8-3-2-7-17(18)19(21)16-6-4-5-15(13-16)14-20-9-11-23-12-10-20/h2-8,13H,9-12,14H2,1H3
SMILES:COc1ccccc1C(=O)c1cccc(c1)CN1CCSCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.