CAS 95648-10-5

potassium (4-hydroxy-1-naphthyl) sulfate

Description:

Potassium (4-hydroxy-1-naphthyl) sulfate, with the CAS number 95648-10-5, is an organic compound that features a naphthalene derivative with a hydroxyl group at the 4-position and a sulfate group. This compound is typically characterized by its solubility in water due to the presence of the sulfate group, which enhances its ionic nature. It exhibits properties associated with both naphthalene derivatives and sulfate esters, making it useful in various applications, including as a reagent in organic synthesis and potentially in dye chemistry. The hydroxyl group contributes to its reactivity, allowing for hydrogen bonding and interactions with other polar substances. Additionally, the compound may display biological activity, which can be of interest in pharmaceutical research. Its stability under standard conditions and the ability to form salts with potassium ions further define its chemical behavior. Overall, potassium (4-hydroxy-1-naphthyl) sulfate is a versatile compound with applications in both industrial and research settings.

Formula: C₁₀H₇KO₅S

InChI: InChI=1/C10H8O5S.K/c11-9-5-6-10(15-16(12,13)14)8-4-2-1-3-7(8)9;/h1-6,11H,(H,12,13,14);/q;+1/p-1

SMILES: c1ccc2c(c1)c(ccc2OS(=O)(=O)O)O.K

Synonyms:

• 1,4-Naphthalenediol Monohydrogen Sulfate Monopotassium Salt
• Potassium 1-Hydroxy-4-naphthol Sulfate