CAS 517-44-2
:Sennidin B
Beschreibung:
Sennidin B, mit der CAS-Nummer 517-44-2, ist eine natürliche Verbindung, die als Glykosid klassifiziert ist, spezifisch als eine Art von Anthraquinon-Glykosid. Es wird hauptsächlich aus der Senna-Pflanze gewonnen, die für ihre Verwendung als Abführmittel bekannt ist. Die Verbindung zeigt eine gelblich-braune Farbe und kommt typischerweise in Form eines kristallinen Feststoffs vor. Sennidin B ist bemerkenswert für seine pharmakologischen Eigenschaften, insbesondere seine Fähigkeit, die Darmbewegungen zu stimulieren, indem es die Peristaltik im Darm fördert. Sein Wirkmechanismus umfasst die Hydrolyse der glykosidischen Bindung, wodurch das aktive Aglykon freigesetzt wird, das eine abführende Wirkung hat. Darüber hinaus kann Sennidin B antioxidative Eigenschaften besitzen, die zu seinen potenziellen gesundheitlichen Vorteilen beitragen. Die Verbindung ist in Wasser und Alkohol löslich, was sie für verschiedene Formulierungen in der Kräutermedizin geeignet macht. Wie bei vielen Naturprodukten hängen die Sicherheit und Wirksamkeit von Sennidin B von der Dosierung und den individuellen Gesundheitszuständen ab, was eine sorgfältige Überlegung bei der Anwendung erfordert.
Formel:C30H18O10
InChl:InChI=1/C30H18O10/c31-17-5-1-3-13-21(15-7-11(29(37)38)9-19(33)25(15)27(35)23(13)17)22-14-4-2-6-18(32)24(14)28(36)26-16(22)8-12(30(39)40)10-20(26)34/h1-10,21-22,31-34H,(H,37,38)(H,39,40)/t21-,22+
InChI Key:InChIKey=JPMRHWLJLNKRTJ-SZPZYZBQNA-N
SMILES:O=C1C=2C([C@@](C=3C1=C(O)C=CC3)([C@@]4(C=5C(C(=O)C=6C4=CC=CC6O)=C(O)C=C(C(O)=O)C5)[H])[H])=CC(C(O)=O)=CC2O
Synonyme:- (9,9'-Bianthracene)-2,2'-dicarboxylic acid, 9,9',10,10'-tetrahydro-4,4',5,5'-tetrahydroxy-10,10'-dioxo-, (R*,S*)-
- 4,4',5,5'-Tetrahydroxy-10,10'-Dioxo-9,9',10,10'-Tetrahydro-9,9'-Bianthracene-2,2'-Dicarboxylic Acid
- 9-[(9R)-2-carboxy-4,5-dihydroxy-10-oxo-9H-anthracen-9-yl]-4,5-dihydroxy-10-oxo-9H-anthracene-2-carboxylic acid
- Nsc 658576
- Sennidin B
- Sennidine B
- [9,9′-Bianthracene]-2,2′-dicarboxylic acid, 9,9′,10,10′-tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo-, (9R,9′S)-rel-
- [9,9′-Bianthracene]-2,2′-dicarboxylic acid, 9,9′,10,10′-tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo-, (R*,S*)-
- [9,9′-Bianthracene]-2,2′-dicarboxylic acid, 9,9′,10,10′-tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo-, meso-
- rel-(9R,9′S)-9,9′,10,10′-Tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo[9,9′-bianthracene]-2,2′-dicarboxylic acid
Sortieren nach
Reinheit (%)
0
100
|
0
|
50
|
90
|
95
|
100
9 Produkte gefunden.
Sennidine B
CAS:Sennidine B analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formel:C30H18O10Reinheit:(HPLC) ≥90%Farbe und Form:PowderMolekulargewicht:538.46rel-(9R,9′S)-9,9′,10,10′-Tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo[9,9′-bianthracene]-2,2′-dicarboxylic acid
CAS:rel-(9R,9′S)-9,9′,10,10′-Tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo[9,9′-bianthracene]-2,2′-dicarboxylic acidFormel:C30H18O10Reinheit:98%Molekulargewicht:538.46Sennidin B
CAS:Sennidin B stimulates glucose incorporation in rat adipocytes.Formel:C30H18O10Reinheit:95%~99%Molekulargewicht:538.464Sennidine B
CAS:Sennidine B is a natural anthraquinone compound, which is derived from the plant species of the genus Senna. This compound functions primarily by promoting peristalsis in the colon, thus facilitating bowel movements. Sennidine B achieves this by modulating ion transport in the intestinal epithelium, enhancing water and electrolyte secretion, and stimulating the colonic muscles.
Reinheit:Min. 95%Molekulargewicht:538.46 g/mol








