CAS: 947692-14-0 - 1-[[(1-Methylethoxy)carbonyl]oxy]ethyl (6R,7R)-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate
Formula:C20H25N5O8S2
InChI:InChI=1S/C20H25N5O8S2/c1-8(2)31-20(29)33-10(4)32-18(28)14-9(3)6-34-17-13(16(27)25(14)17)23-15(26)12(24-30-5)11-7-35-19(21)22-11/h7-8,10,13,17H,6H2,1-5H3,(H2,21,22)(H,23,26)/b24-12-/t10?,13-,17-/m1/s1
InChI key:InChIKey=IETSABQUOKHCMQ-PUONPJMJSA-N
SMILES:O=C(OC(OC(=O)C1=C(C)CSC2N1C(=O)C2NC(=O)C(=NOC)C=3N=C(SC3)N)C)OC(C)C
Marchio | Dati del prodotto | Purezza | Fascia di prezzo | Consegna prevista |
---|---|---|---|---|
Cefpodoxime Proxetil EP Impurity B (Mixture of Diastereomers) REF: 4Z-C-853CAS: 947692-14-0 | - - - | Prezzo su richiesta | Mar 04 Giu 24 | |
3-Methyl 3-De(methoxymethyl) Cefpodoxime REF: TR-M295700CAS: 947692-14-0 | - - - | 1.276,00 € | Mar 11 Giu 24 | |
Cefpodoxime proxetil impurity B REF: 3D-FC63693CAS: 947692-14-0 | Min. 95% | Prezzo su richiesta | Lun 15 Lug 24 |
Cefpodoxime Proxetil EP Impurity B (Mixture of Diastereomers)
Ref: 4Z-C-853
10mg | Prezzo su richiesta | |
25mg | Prezzo su richiesta | |
50mg | Prezzo su richiesta | |
100mg | Prezzo su richiesta |
3-Methyl 3-De(methoxymethyl) Cefpodoxime
Ref: TR-M295700
10mg | 1.276,00 € |
Cefpodoxime proxetil impurity B
Ref: 3D-FC63693
25mg | Prezzo su richiesta |