CAS 10001-82-8

Fórmula: C24H26N4O5S

InChI: InChI=1S/C24H26N4O5S/c1-24(2)18(23(32)33)28-21(31)17(22(28)34-24)27-20(30)16(14-11-7-4-8-12-14)26-19(29)15(25)13-9-5-3-6-10-13/h3-12,15-18,22H,25H2,1-2H3,(H,26,29)(H,27,30)(H,32,33)/t15-,16-,17-,18+,22-/m1/s1

Chave InChI: ZHYDGVCSWXXUDM-OSAVLUCMSA-N

SMILES: CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=CC=C3)NC(=O)[C@@H](C4=CC=CC=C4)N)C(=O)O)C

Ampicillin EP Impurity I

CAS: 10001-82-8

Fórmula: C₂₄H₂₆N₄O₅S

Cor e Forma: White To Off-White Solid

Peso molecular: 482.56

Ref: 4Z-A-669

Ampicillin Amino-benzeneacetaldehyde

Produto Controlado

CAS: 10001-82-8

Fórmula: C₂₄H₂₆N₄O₅S

Cor e Forma: Neat

Peso molecular: 482.55

Ref: TR-A634375

Ampicillin amino-benzeneacetaldehyde

CAS: 10001-82-8

Ampicillin amino-benzeneacetaldehyde is a specialized biochemical compound, which is a derivative of the well-known antibiotic ampicillin. This compound serves as an advanced progenitor in the synthesis of tailored antibiotics, stemming from both natural and semi-synthetic sources. The primary mode of action for this derivative involves its transformation into active ampicillin forms, which then inhibit bacterial cell wall synthesis by binding to penicillin-binding proteins. This mechanism effectively compromises the structural integrity of bacterial cells, leading to their eventual lysis.

Fórmula: C₂₄H₂₆N₄O₅S

Pureza: Min. 95%

Peso molecular: 482.6 g/mol

Ref: 3D-KAA00182

Ampicillin EP Impurity I

CAS: 10001-82-8

Fórmula: C₂₄H₂₆N₄O₅S

Peso molecular: 482.55

Ref: ST-EA-CP-A59009