CAS 100648-56-4

Fórmula: C17H14O7

InChI: InChI=1S/C17H14O7/c1-22-11-4-3-8(5-10(11)19)17-16(21)15(20)14-12(23-2)6-9(18)7-13(14)24-17/h3-7,18-19,21H,1-2H3

Chave InChI: QTUNBLFELCXAOU-UHFFFAOYSA-N

SMILES: COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(O2)C=C(C=C3OC)O)O)O

4',5-Di-O-methyl quercetin

CAS: 100648-56-4

4',5-Di-O-methyl quercetin is a naturally occurring quercetin derivative with the potential to induce differentiation of human stem cells into hepatocytes.

Fórmula: C₁₇H₁₄O₇

Cor e Forma: Solid

Peso molecular: 330.2889

Ref: TM-T126543

4',5-Di-o-methyl quercetin

CAS: 100648-56-4

4',5-Di-O-methyl quercetin is a specialized methylated flavonoid, which is a type of polyphenolic compound. It is derived from various plant sources, often found in species that synthesize flavonoids as part of their secondary metabolism. The compound undergoes methylation, a biochemical process wherein methyl groups are added, enhancing its stability and altering its biological activity compared to non-methylated flavonoids.

Fórmula: C₁₇H₁₄O₇

Pureza: Min. 95%

Peso molecular: 330.29 g/mol

Ref: 3D-AEA64856