CAS 1009318-60-8

Fórmula: C15H21NO4

InChI: InChI=1S/C15H21NO4/c1-19-14-11(6-7-12(17)15(14)20-2)13(18)9-10-5-3-4-8-16-10/h6-7,10,16-17H,3-5,8-9H2,1-2H3/t10-/m0/s1

Chave InChI: MCMMIRWNWGZONI-JTQLQIEISA-N

SMILES: COC1=C(C=CC(=C1OC)O)C(=O)C[C@@H]2CCCCN2

Caulophyllumine A

CAS: 1009318-60-8

Caulophyllumine A is a useful organic compound for research related to life sciences and the catalog number is T126534.

Fórmula: C₁₅H₂₁NO₄

Cor e Forma: Solid

Peso molecular: 279.33

Ref: TM-T126534

Caulophyllumine A

Produto Controlado

CAS: 1009318-60-8

Fórmula: C₁₅H₂₁NO₄

Cor e Forma: Neat

Peso molecular: 279.332

Ref: TR-C186080

Caulophyllumine A

CAS: 1009318-60-8

Caulophyllumine A is an alkaloid compound, which is derived from the plant species *Caulophyllum thalictroides*, commonly known as blue cohosh. This plant, native to North American forests, has been traditionally used in herbal medicine. The mode of action of Caulophyllumine A involves modulation of various cellular pathways, potentially influencing processes such as inflammation and cell signaling, although the exact molecular mechanisms are still being investigated.

Fórmula: C₁₅H₂₁NO₄

Pureza: Min. 95%

Peso molecular: 279.33 g/mol

Ref: 3D-JQB31860