CAS 10164-73-5

Fórmula: C20H36O5

InChI: InChI=1S/C20H36O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-19,21-23H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16+,17+,18+,19+/m0/s1

Chave InChI: DZUXGQBLFALXCR-JQXWHSLNSA-N

SMILES: CCCCC[C@@H](/C=C/[C@H]1[C@@H](C[C@H]([C@@H]1CCCCCCC(=O)O)O)O)O

7-((1R,2R,3R,5R)-3,5-Dihydroxy-2-((S,E)-3-hydroxyoct-1-en-1-yl)cyclopentyl)heptanoic acid

CAS: 10164-73-5

7-((1R,2R,3R,5R)-3,5-Dihydroxy-2-((S,E)-3-hydroxyoct-1-en-1-yl)cyclopentyl)heptanoic acid

Peso molecular: 356.5029907

Ref: 10-F924279

Alprostadil (Prostaglandin E1) Impurity 12

CAS: 10164-73-5

Fórmula: C₂₀H₃₆O₅

Peso molecular: 356.50

Ref: 4Z-P-144047

Prostaglandin F1β

CAS: 10164-73-5

Fórmula: C₂₀H₃₆O₅

Peso molecular: 356.5

Ref: BE-RMCP378044

Prostaglandin F1β

CAS: 10164-73-5

PGF1β, a biochemical compound, functions as a pivotal mediator in inflammatory processes and plays an integral role in uterine contractions. It exhibits significant regulatory effects on platelet aggregation and vasodilation, demonstrating its critical importance in cardiovascular health. Additionally, PGF1β contributes to the regulation of kidney function and electrolyte balance, illustrating its widespread impact across various physiological systems.

Fórmula: C₂₀H₃₆O₅

Cor e Forma: Solid

Peso molecular: 356.5

Ref: TM-T84530

Prost-13-en-1-oic acid, 9,11,15-trihydroxy-, (9β,11α,13E,15S)-

CAS: 10164-73-5

Fórmula: C₂₀H₃₆O₅

Peso molecular: 356.4968

Ref: IN-DA00050X