CAS 1017083-18-9

Fórmula: C19H18O6

InChI: InChI=1S/C19H18O6/c1-21-12-7-5-6-11(10-12)16-19(24-4)15(20)13-8-9-14(22-2)18(23-3)17(13)25-16/h5-10H,1-4H3

Chave InChI: AZBFLDLYPARPDM-UHFFFAOYSA-N

SMILES: COC1=C(C2=C(C=C1)C(=O)C(=C(O2)C3=CC(=CC=C3)OC)OC)OC

3,7,8,3'-Tetramethoxyflavone

CAS: 1017083-18-9

3,7,8,3'-Tetramethoxyflavone is a naturally occurring flavonoid compound, which is derived from various plant sources, particularly those in the genus Kaempferia and others known for their rich phytochemical profiles. As a secondary metabolite, it has been studied for its potential pharmacological benefits and biological activities. The mode of action of 3,7,8,3'-Tetramethoxyflavone includes modulation of signaling pathways and interaction with specific enzymes and receptors, contributing to its anti-inflammatory, antioxidant, and potential anticancer properties. Researchers have explored its effects on cellular processes such as apoptosis and cell cycle regulation, making it a compound of interest in drug discovery and development. Additionally, 3,7,8,3'-Tetramethoxyflavone has been investigated for its role in neuroprotection and its capacity to interact with biochemical pathways involved in neurodegenerative diseases. This compound continues to be a focal point in studies aimed at understanding its contributions to health and disease prevention at the molecular level.

Fórmula: C₁₉H₁₈O₆

Pureza: Min. 95%

Cor e Forma: Powder

Peso molecular: 342.34 g/mol

Ref: 3D-XT183007