CAS 1026438-56-1

Fórmula: C37H38N4O2

InChI: InChI=1S/C37H38N4O2/c1-7-12-33-38-31-22-27(35-39-30-15-10-11-16-32(30)40(35)6)21-24(2)34(31)41(33)23-25-17-19-26(20-18-25)28-13-8-9-14-29(28)36(42)43-37(3,4)5/h8-11,13-22H,7,12,23H2,1-6H3

Chave InChI: ZDOPWPNJFDIROE-UHFFFAOYSA-N

SMILES: CCCC1=NC2=C(N1CC3=CC=C(C=C3)C4=CC=CC=C4C(=O)OC(C)(C)C)C(=CC(=C2)C5=NC6=CC=CC=C6N5C)C

Telmisartan Impurity 5

CAS: 1026438-56-1

Fórmula: C₃₇H₃₈N₄O₂

Cor e Forma: White To Off-White Solid

Peso molecular: 570.74

Ref: 4Z-T-138

Telmisartan Impurity B

CAS: 1026438-56-1

Fórmula: C₃₇H₃₈N₄O₂

Cor e Forma: Neat

Peso molecular: 570.723

Ref: TR-T017005

Telmisartan impurity B

CAS: 1026438-56-1

Telmisartan impurity B is a potent anticancer agent that has been extensively studied for its medicinal properties. It acts as a kinase inhibitor, specifically targeting cyclin-dependent kinases in cancer cells. This inhibitor selectively blocks the activity of these kinases, which are involved in the regulation of cell division and proliferation, leading to apoptosis or programmed cell death. Telmisartan impurity B has been shown to be effective against various types of cancer cells, including those from Chinese hamsters and humans. This protein analog has been extensively researched for its ability to induce apoptosis in tumor cells, making it a promising candidate for future cancer therapies.

Fórmula: C₃₇H₃₈N₄O₂

Pureza: Min. 95%

Peso molecular: 570.7 g/mol

Ref: 3D-BRB43856

Telmisartan Impurity B

CAS: 1026438-56-1

Fórmula: C₃₇H₃₈N₄O₂

Peso molecular: 570.72

Ref: ST-EA-CP-T4036