CAS 1049743-58-9

Fórmula: C17H13Cl3N4O

InChI: InChI=1S/C17H11ClN4O.2ClH/c18-11-6-13-12-3-5-20-9-15(12)21-16(13)14(7-11)22-17(23)10-2-1-4-19-8-10;;/h1-9,21H,(H,22,23);2*1H

Chave InChI: QTDCBADLGJZBHP-UHFFFAOYSA-N

SMILES: C1=CC(=CN=C1)C(=O)NC2=CC(=CC3=C2NC4=C3C=CN=C4)Cl.Cl.Cl

PS 1145 dihydrochloride

CAS: 1049743-58-9

PS 1145 dihydrochloride

Fórmula: C₁₆H₁₇NO₃S

Pureza: 98%

Peso molecular: 303.38

Ref: 54-OR1107128

PS 1145 dihydrochloride

CAS: 1049743-58-9

IκB kinase (IKK) inhibitor

Fórmula: C₁₇H₁₃Cl₃N₄O

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 395.67

Ref: TM-T23191

N-(6-Chloro-9H-pyrido[3,4-b]indol-8-yl)pyridine-3-carboxamide dihydrochloride

CAS: 1049743-58-9

Pureza: 98%

Ref: IN-DA01ENO7

Ps-1145 dihydrochloride

CAS: 1049743-58-9

PS-1145 dihydrochloride is a synthetic chemical compound that acts as a selective inhibitor of the enzyme IκB kinase β (IKK-β). This compound is typically derived through complex chemical synthesis techniques in laboratory environments. PS-1145 targets the NF-κB signaling pathway by directly binding to IKK-β, thereby inhibiting its activity. This inhibition prevents the phosphorylation and subsequent degradation of IκB proteins, which in turn retains NF-κB in the cytoplasm and prevents its transcriptional activity in the nucleus.

Fórmula: C₁₇H₁₃Cl₃N₄O

Pureza: Min. 95%

Peso molecular: 395.7 g/mol

Ref: 3D-ZRB74358