CAS 104975-02-2

Fórmula: C17H24O3

InChI: InChI=1S/C17H24O3/c1-9(2)17-14-6-11(4)16(20-12(5)18)8-13(14)10(3)7-15(17)19/h6,10,13-14,16H,7-8H2,1-5H3/t10-,13+,14+,16+/m1/s1

Chave InChI: HIEJMYXUMUNVKS-NCFRWKGYSA-N

SMILES: C[C@@H]1CC(=O)C(=C(C)C)[C@@H]2[C@H]1C[C@@H](C(=C2)C)OC(=O)C

3-Acetoxy-4,7(11)-cadinadien-8-one

CAS: 104975-02-2

3-Acetoxy-4,7(11)-cadinadien-8-one is a natural product for research related to life sciences. The catalog number is TN2916 and the CAS number is 104975-02-2.

Fórmula: C₁₇H₂₄O₃

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 276.37

Ref: TM-TN2916

3-Acetoxy-4,7(11)-cadinadien-8-one

CAS: 104975-02-2

Fórmula: C₁₇H₂₄O₃

Pureza: 95%~99%

Cor e Forma: Powder

Peso molecular: 276.376

Ref: BP-SBP01399

3-Acetoxy-4,7(11)-cadinadien-8-one

CAS: 104975-02-2

3-Acetoxy-4,7(11)-cadinadien-8-one is a sesquiterpenoid, which is a type of terpenoid composed of three isoprene units. This compound is typically sourced from various essential oils, where it contributes to the structural diversity inherent to plant-produced terpenoids. These natural products often exhibit complex biosynthetic pathways that allow for the generation of diverse molecular architectures.

Fórmula: C₁₇H₂₄O₃

Pureza: Min. 95%

Peso molecular: 276.4 g/mol

Ref: 3D-EEA97502