CAS 106623-23-8

Fórmula: C20H28O4

InChI: InChI=1S/C20H28O4/c1-9(2)11-7-13-17-15(16(11)18(22)19(13,5)23)12(10(3)4)8-14(21)20(17,6)24/h7-10,13,15-17,23-24H,1-6H3/t13-,15-,16+,17+,19+,20-/m0/s1

Chave InChI: YNYHPBIGKWCFOA-GNNUITGDSA-N

SMILES: CC(C)C1=C[C@H]2[C@@H]3[C@H]([C@@H]1C(=O)[C@]2(C)O)C(=CC(=O)[C@]3(C)O)C(C)C

3,10-Dihydroxy-5,11-dielmenthadiene-4,9-dione

CAS: 106623-23-8

3,10-Dihydroxy-5,11-dielmenthadiene-4,9-dione is a natural product of Callitris, Cupressaceae.

Fórmula: C₂₀H₂₈O₄

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 332.44

Ref: TM-TN2852

3,10-Dihydroxydielmentha-5,11-diene-4,9-dione

CAS: 106623-23-8

Fórmula: C₂₀H₂₈O₄

Pureza: 95%~99%

Cor e Forma: Powder

Peso molecular: 332.44

Ref: BP-SBP00799

3,10-Dihydroxy-5,11-dielmenthadiene-4,9-dione

CAS: 106623-23-8

3,10-Dihydroxy-5,11-dielmenthadiene-4,9-dione is a diterpenoid compound, which is isolated from natural sources such as certain plant species. These plants often produce this compound as part of their secondary metabolites, which are involved in defense mechanisms against pathogens and herbivores. The mode of action of 3,10-Dihydroxy-5,11-dielmenthadiene-4,9-dione involves various biochemical interactions at the cellular level, potentially influencing enzyme activity, signaling pathways, and gene expression.

Fórmula: C₂₀H₂₈O₄

Pureza: Min. 95%

Peso molecular: 332.4 g/mol

Ref: 3D-GEA62323