CAS 1099687-80-5

Fórmula: C18H20O5

InChI: InChI=1S/C18H20O5/c1-2-3-12-8-11(4-6-15(12)20)14-9-13(5-7-16(14)21)18(23)17(22)10-19/h2,4-9,17-23H,1,3,10H2/t17-,18-/m0/s1

Chave InChI: LKYOLPWSGNGKSH-ROUUACIJSA-N

SMILES: C=CCC1=C(C=CC(=C1)C2=C(C=CC(=C2)[C@@H]([C@H](CO)O)O)O)O

(1S,2S)-threo-Honokitriol

CAS: 1099687-80-5

(1S,2S)-threo-Honokitriol is a natural product of Magnolia, Magnoliaceae.

Fórmula: C₁₈H₂₀O₅

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 316.35

Ref: TM-TN6655

(1S,2S)-Threo-honokitriol

CAS: 1099687-80-5

(1S,2S)-Threo-honokitriol is a bioactive compound, which is a lignan derived from plants of the Magnolia species. This compound, structurally classified as a neolignan, is extracted from the diverse Magnoliaceae family, known for its pharmacologically active constituents. The mode of action of (1S,2S)-Threo-honokitriol involves modulating molecular pathways related to anti-inflammatory and antioxidant activities. Its ability to influence cellular processes is largely attributed to its interaction with specific signaling pathways and gene expression profiles associated with inflammatory responses.

Fórmula: C₁₈H₂₀O₅

Pureza: Min. 95%

Peso molecular: 316.30 g/mol

Ref: 3D-ZTB68780