CAS 1112978-84-3

Fórmula: C17H13N3O3

InChI: InChI=1S/C17H13N3O3/c21-16-13(8-11-6-7-14-15(9-11)23-10-22-14)19-17(20-16)18-12-4-2-1-3-5-12/h1-9H,10H2,(H2,18,19,20,21)/b13-8-

Chave InChI: PGPHHJBZEGSUNE-JYRVWZFOSA-N

SMILES: C1OC2=C(O1)C=C(C=C2)/C=C\3/C(=O)NC(=N3)NC4=CC=CC=C4

Leucettine L41

CAS: 1112978-84-3

Leucettine L41

Fórmula: C₁₇H₁₃N₃O₃

Pureza: ≥98%

Peso molecular: 307.3

Ref: 54-BUP21199

Leucettine L41

CAS: 1112978-84-3

Leucettine L41 (LeucettineL41) is an inhibitor of DYRKs/CLKs, preferentially targeting DYRK1A, and inhibits DYRK2.

Fórmula: C₁₇H₁₃N₃O₃

Pureza: 99.08%

Cor e Forma: Solid

Peso molecular: 307.3

Ref: TM-T24402

Leucettine L41

CAS: 1112978-84-3

Fórmula: C₁₇H₁₃N₃O₃

Pureza: ≥ 98%

Cor e Forma: Off-white to beige solid

Peso molecular: 307.3

Ref: 7W-GL8276

Leucettine L41

CAS: 1112978-84-3

(Z)-4-(Benzo[d][1,3]dioxol-5-ylmethylene)-2-(phenylamino)-1H-imidazol-5(4H)-one

Fórmula: C₁₇H₁₃N₃O₃

Pureza: 99%

Peso molecular: 307.3

Ref: IN-DG01304438

Leucettine L41

CAS: 1112978-84-3

Leucettine L41 is a small-molecule inhibitor, derived from marine sponge alkaloids, that targets dual-specificity tyrosine-regulated kinase-1A (DYRK1A) and related kinases. As a product originating from bioactive compounds isolated from the marine environment, its unique structure allows it to interact specifically with its target enzymes.

Fórmula: C₁₇H₁₃N₃O₃

Pureza: Min. 95%

Peso molecular: 307.3 g/mol

Ref: 3D-MUB97884