CAS 111687-37-7

Fórmula: C11H15N5O4

InChI: InChI=1S/C11H15N5O4/c12-11-14-9-6(10(20)15-11)13-3-16(9)5-1-4(2-17)7(18)8(5)19/h3-5,7-8,17-19H,1-2H2,(H3,12,14,15,20)/t4-,5-,7-,8+/m1/s1

Chave InChI: KIDOTSCXAILVGR-APOSLCTFSA-N

SMILES: C1[C@@H]([C@H]([C@H]([C@@H]1N2C=NC3=C2N=C(NC3=O)N)O)O)CO

Hsv-tk substrate

CAS: 111687-37-7

HSV-tk substrate is a nucleotide analogue, which is a synthetic compound derived from the herpes simplex virus thymidine kinase (HSV-tk) gene. This substrate is specifically phosphorylated by the HSV-tk enzyme, a property that provides significant utility in molecular biology and genetic research. The mode of action involves the selective phosphorylation of the substrate by HSV-tk, which is typically absent in mammalian cells but can be introduced via genetic engineering. Once phosphorylated, the substrate becomes toxic to the host cell, allowing researchers to selectively target and eliminate cells expressing the HSV-tk gene.

Fórmula: C₁₁H₁₅N₅O₄

Pureza: Min. 95%

Peso molecular: 281.27 g/mol

Ref: 3D-LEA68737

HSV-TK substrate

CAS: 111687-37-7

HSV-TK substrate is a substrate for HSV-TK with antitumor activity. It induces multi-log cytotoxicity in HSV-TK-expressing and bystander cells.

Fórmula: C₁₁H₁₅N₅O₄

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 281.27

Ref: TM-T11582