CAS 1135251-65-8

Fórmula: C21H30N4O2

InChI: InChI=1S/C21H30N4O2/c22-20(23)17-10-7-16(8-11-17)14-24-21(27)18-6-3-13-25(18)19(26)12-9-15-4-1-2-5-15/h7-8,10-11,15,18H,1-6,9,12-14H2,(H3,22,23)(H,24,27)/t18-/m0/s1

Chave InChI: BNCHHUFGEOJCNH-SFHVURJKSA-N

SMILES: C1CCC(C1)CCC(=O)N2CCC[C@H]2C(=O)NCC3=CC=C(C=C3)C(=N)N

(S)-N-(4-Carbamimidoylbenzyl)-1-(3-cyclopentylpropanoyl)pyrrolidine-2-carboxamide

Produto Controlado

CAS: 1135251-65-8

Fórmula: C₂₁H₃₀N₄O₂

Cor e Forma: Neat

Peso molecular: 370.488

Ref: TR-C142695

(2S)-N-[(4-Carbamimidoylphenyl)methyl]-1-(3-cyclopentylpropanoyl)pyrrolidine-2-carboxamide

CAS: 1135251-65-8

(2S)-N-[(4-Carbamimidoylphenyl)methyl]-1-(3-cyclopentylpropanoyl)pyrrolidine-2-carboxamide is a research tool that inhibits ion channels. It is an inhibitor of ligand-gated ion channels and voltage-gated ion channels. This compound binds to a receptor site in the channel and prevents ions from passing through the channel. It has been shown to inhibit ligand-gated ion channels such as nicotinic acetylcholine receptors, serotonin receptors, and GABA receptors. (2S)-N-[(4-Carbamimidoylphenyl)methyl]-1-(3-cyclopentylpropanoyl)pyrrolidine-2-carboxamide also inhibits voltage gated ion channels such as calcium, sodium, potassium, and chloride channels. This compound can be used in pharmacology studies to explore the structure of ligand

Pureza: Min. 95%

Ref: 3D-BC178189