CAS 1179347-65-9

Fórmula: C21H14N2O2

InChI: InChI=1S/C21H14N2O2/c22-11-16-12-23-18-9-8-15(10-17(16)18)13-4-6-14(7-5-13)21-19(24)2-1-3-20(21)25/h1-10,12,23-25H

Chave InChI: IGSYZPLXAFVMKY-UHFFFAOYSA-N

SMILES: C1=CC(=C(C(=C1)O)C2=CC=C(C=C2)C3=CC4=C(C=C3)NC=C4C#N)O

MT 63-78

CAS: 1179347-65-9

MT 63-78 is a specific and effective direct AMPK activator (EC50: 25 μM).

Fórmula: C₂₁H₁₄N₂O₂

Pureza: 97.11% - 98.95%

Cor e Forma: White Solid

Peso molecular: 326.3481

Ref: TM-T16156

MT 63-78

CAS: 1179347-65-9

MT 63-78

Fórmula: C₂₁H₁₄N₂O₂

Pureza: ≥95%

Peso molecular: 326.35

Ref: 54-BUP05458

5-{2',6'-dihydroxy-[1,1'-biphenyl]-4-yl}-1H-indole-3-carbonitrile

CAS: 1179347-65-9

Fórmula: C₂₁H₁₄N₂O₂

Pureza: 98.95%

Peso molecular: 326.3481

Ref: IN-DA00ILGR

MT 63-78

CAS: 1179347-65-9

MT 63-78 is a synthetic peptide, which is a product of advanced bioengineering technologies with the potential to modulate specific physiological pathways. It is derived from rational design processes that utilize the sequencing of amino acids to achieve a precise formulation that can interact with biological targets at a molecular level. Its mode of action involves binding to specific receptors or proteins, thereby influencing signaling pathways that are critical in cellular processes.

Fórmula: C₂₁H₁₄N₂O₂

Pureza: Min. 95%

Cor e Forma: Powder

Peso molecular: 326.3 g/mol

Ref: 3D-EXB34765

MT 63-78

CAS: 1179347-65-9

Pureza: 95%

Peso molecular: 326.106

Ref: 10-F824780