CAS 118101-72-7

Fórmula: C15H22O2

InChI: InChI=1S/C15H22O2/c1-8(2)10-5-6-15(4)9(3)12-13(10)11(15)7-17-14(12)16/h8,10-13H,3,5-7H2,1-2,4H3/t10-,11+,12+,13+,15+/m1/s1

Chave InChI: YRJUYCPYOZTNDX-MCZMQQNQSA-N

SMILES: CC(C)[C@H]1CC[C@@]2([C@@H]3[C@H]1[C@H](C2=C)C(=O)OC3)C

Prehelminthosporolactone

CAS: 118101-72-7

Prehelminthosporolactone is a phytotoxin.

Fórmula: C₁₅H₂₂O₂

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 234.339

Ref: TM-TN4823

Prehelminthosporolactone

CAS: 118101-72-7

Prehelminthosporolactone is a secondary metabolite, which is a chemical compound produced by fungi. It is typically isolated from species of the genus *Helminthosporium*, which thrive in various environmental conditions. As a secondary metabolite, prehelminthosporolactone is not essential for the basic metabolic functions of the fungi but plays a crucial role in ecological interactions and survival strategies. It can serve as a defensive compound against other microorganisms or herbivores or may facilitate communication between different organisms.

Fórmula: C₁₅H₂₂O₂

Pureza: Min. 95%

Peso molecular: 234.33 g/mol

Ref: 3D-TEA10172