CAS 118292-15-2

Fórmula: C18H24O12

InChI: InChI=1S/C18H24O12/c1-6(21)28-9-2-7(3-19)11-12(9)8(16(25)26)5-27-17(11)30-18-15(24)14(23)13(22)10(4-20)29-18/h2,5,9-15,17-20,22-24H,3-4H2,1H3,(H,25,26)/t9-,10-,11-,12+,13-,14+,15-,17+,18+/m1/s1

Chave InChI: DKSJVXMWGQVIEW-FUIAOSIISA-N

SMILES: CC(=O)O[C@@H]1C=C([C@@H]2[C@H]1C(=CO[C@H]2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C(=O)O)CO

6-O-Acetylscandoside

CAS: 118292-15-2

Fórmula: C₁₈H₂₄O₁₂

Pureza: 95%~99%

Peso molecular: 432.378

Ref: BP-BP3041

6-O-Acetylscandoside

CAS: 118292-15-2

6-O-Acetylscandoside is a natural compound classified as an iridoid glycoside, sourced primarily from certain plant species known for their medicinal properties. The molecular structure of this compound includes an acetyl group attached to the 6-O position of scandoside, a modification that is significant in understanding its bioactivity. Iridoid glycosides like 6-O-Acetylscandoside are secondary metabolites in plants, often implicated in defense mechanisms against herbivores and pathogens.

Fórmula: C₁₈H₂₄O₁₂

Pureza: Min. 95%

Peso molecular: 432.38 g/mol

Ref: 3D-FA146188