CAS 1246282-67-6

Fórmula: C29H36O

InChI: InChI=1S/C29H36O/c1-23(2)10-9-15-26-17-20-28(29(30)21-18-25-13-7-4-8-14-25)27(22-26)19-16-24-11-5-3-6-12-24/h3-8,10-14,17,27-28H,9,15-16,18-22H2,1-2H3

Chave InChI: NXIXBHMKUKUWCV-UHFFFAOYSA-N

SMILES: CC(=CCCC1=CCC(C(C1)CCC2=CC=CC=C2)C(=O)CCC3=CC=CC=C3)C

Officinaruminane B

CAS: 1246282-67-6

Officinaruminane B is a useful organic compound for research related to life sciences and the catalog number is T126156.

Fórmula: C₂₉H₃₆O

Cor e Forma: Solid

Peso molecular: 400.60

Ref: TM-T126156

Officinaruminane B

CAS: 1246282-67-6

Officinaruminane B is a diterpenoid compound, which is a type of bioactive metabolite. It is derived from natural plant sources, specifically identified in certain species of the Ruta genus. The mode of action for Officinaruminane B involves the modulation of specific biological pathways, which may include interacting with cellular receptors or enzymes, leading to potential anti-inflammatory, antimicrobial, or anticancer effects depending on the context of its application.

Fórmula: C₂₉H₃₆O

Pureza: Min. 95%

Peso molecular: 400.60 g/mol

Ref: 3D-WZB28267