CAS 153316-01-9

Fórmula: C47H76N10O14

InChI: InChI=1S/C47H76N10O14/c1-7-26(5)38(57-46(69)39(27(6)8-2)56-40(63)29(49)17-19-36(59)60)45(68)54-33(24-35(50)58)44(67)53-32(23-28-14-10-9-11-15-28)43(66)52-31(18-20-37(61)62)42(65)51-30(16-12-13-21-48)41(64)55-34(47(70)71)22-25(3)4/h9-11,14-15,25-27,29-34,38-39H,7-8,12-13,16-24,48-49H2,1-6H3,(H2,50,58)(H,51,65)(H,52,66)(H,53,67)(H,54,68)(H,55,64)(H,56,63)(H,57,69)(H,59,60)(H,61,62)(H,70,71)/t26-,27-,29-,30-,31-,32-,33-,34-,38-,39-/m0/s1

Chave InChI: KBPDNGCJCDHTEX-MHIFUCQXSA-N

SMILES: CC[C@H](C)[C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)O)NC(=O)[C@H](CCC(=O)O)N

OVA-E1 peptide

CAS: 153316-01-9

OVA-E1 peptide, as SIINFEKL variant, triggers similar p38/JNK activation in mutant and normal thymocytes.

Fórmula: C₄₇H₇₆N₁₀O₁₄

Cor e Forma: Solid

Peso molecular: 1005.181

Ref: TM-T39017

EIINFEKL trifluoroacetate salt

CAS: 153316-01-9

Fórmula: C₄₇H₇₆N₁₀O₁₄·xC₂HF₃O₂

Peso molecular: 1005.16 (free base

Ref: 7W-GK3696

Eiinfekl trifluoroacetate

CAS: 153316-01-9

Eiinfekl trifluoroacetate is a potent inhibitor of the HIV-1 protease. It has been shown to have significant effects against influenza virus and other viruses, including specific types of human papillomavirus and Listeria monocytogenes. Eiinfekl trifluoroacetate binds to the virus's gp120 protein in order to inhibit its ability to infect cells, specifically by blocking cell receptors. The compound also inhibits the activity of antigen-presenting cells, which are responsible for presenting antigens on their surface in order to induce an immune response. Eiinfekl trifluoroacetate has been shown to have a high degree of specificity for certain viruses, such as HIV-1 and Influenza virus, with no significant effects on other proteins or cells.

Fórmula: C₄₇H₇₆N₁₀O₁₄

Pureza: Min. 95%

Peso molecular: 1,005.2 g/mol

Ref: 3D-DGA31601