CAS 154418-16-3

Fórmula: C28H38O13

InChI: InChI=1S/C28H38O13/c1-35-17-6-13(7-18(36-2)22(17)31)5-15-12-39-26(16(15)10-29)14-8-19(37-3)27(20(9-14)38-4)41-28-25(34)24(33)23(32)21(11-30)40-28/h6-9,15-16,21,23-26,28-34H,5,10-12H2,1-4H3/t15?,16?,21-,23-,24+,25-,26?,28+/m1/s1

Chave InChI: OSPNTYPNEPEMIS-PQDWNSJOSA-N

SMILES: COC1=CC(=CC(=C1O)OC)CC2COC(C2CO)C3=CC(=C(C(=C3)OC)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC

5,5'-Dimethoxylariciresil 4-O-glucoside

CAS: 154418-16-3

Fórmula: C₂₈H₃₈O₁₃

Pureza: 98.0%

Peso molecular: 582.5935

Ref: IN-DA00AKVN

5,5'-Dimethoxylariciresinol 4-O-glucoside

CAS: 154418-16-3

5,5'-Dimethoxylariciresinol-4'-O-beta-D-glucoside may improve chemosensitivity, potentially reversing MDR.

Fórmula: C₂₈H₃₈O₁₃

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 582.599

Ref: TM-TN3077

5,5'-Dimethoxylariciresinol 4-O-glucoside

CAS: 154418-16-3

Fórmula: C₂₈H₃₈O₁₃

Pureza: 95%~99%

Cor e Forma: Powder

Peso molecular: 582.599

Ref: BP-SBP01883

5,5'-Dimethoxylariciresinol 4-o-glucoside

CAS: 154418-16-3

5,5'-Dimethoxylariciresinol 4-O-glucoside is a lignan glucoside, which is a phytochemical compound found predominantly in certain plants, particularly in flaxseeds and other lignan-rich seeds. As a naturally occurring product, it belongs to a class of phenolic compounds known for their health-related benefits. Its mode of action primarily involves its role as an antioxidant, helping to neutralize free radicals and thereby reduce oxidative stress in biological systems.

Fórmula: C₂₈H₃₈O₁₃

Pureza: Min. 95%

Peso molecular: 582.6 g/mol

Ref: 3D-EGA41816