CAS 1781834-93-2

Fórmula: C23H25ClFN5O2

InChI: InChI=1S/C23H24FN5O2.ClH/c24-16-5-6-18-15(13-16)14-20(26-18)22(30)25-9-12-28-10-7-17(8-11-28)29-21-4-2-1-3-19(21)27-23(29)31;/h1-6,13-14,17,26H,7-12H2,(H,25,30)(H,27,31);1H

Chave InChI: BNMQCDOCYPGJJD-UHFFFAOYSA-N

SMILES: C1CN(CCC1N2C3=CC=CC=C3NC2=O)CCNC(=O)C4=CC5=C(N4)C=CC(=C5)F.Cl

FIPI hydrochloride

CAS: 1781834-93-2

FIPI hydrochloride

Fórmula: C₂₃H₂₅ClFN₅O₂

Pureza: 98%

Peso molecular: 457.93

Ref: 54-PC1031066

FIPI hydrochloride

CAS: 1781834-93-2

Fórmula: C₂₃H₂₅ClFN₅O₂

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 457.9283

Ref: IN-DA01JTQ6

FIPI HCl

CAS: 1781834-93-2

FIPI: Selective phospholipase D inhibitor, blocks mercury-induced lipid signals, protects aortic cells.

Fórmula: C₂₃H₂₅ClFN₅O₂

Cor e Forma: Solid

Peso molecular: 457.93

Ref: TM-T3580L

FIPI

CAS: 1781834-93-2

FIPI is a protein that is involved in the regulation of cell lysis. It binds to fatty acids and then causes cytosolic calcium levels to increase, leading to cell lysis. FIPI has been shown to be involved in the regulation of epidermal growth factor (EGF) synthesis and signal pathways involving EGF receptors. The role of FIPI in infectious diseases such as HIV infection or malaria is unknown. Studies have found that FIPI can inhibit signal transduction by binding to the receptor for EGF, which may lead to new drugs for the treatment of cancer or viral infections.

Fórmula: C₂₃H₂₅ClFN₅O₂

Pureza: Min. 95%

Peso molecular: 457.9 g/mol

Ref: 3D-GWC83493