CAS 183075-03-8

Fórmula: C10H14O5

InChI: InChI=1S/C10H14O5/c1-10(2)14-7-4-5(9(12)13)3-6(11)8(7)15-10/h4,6-8,11H,3H2,1-2H3,(H,12,13)/t6-,7-,8+/m1/s1

Chave InChI: PILATNHSTHZMCA-PRJMDXOYSA-N

SMILES: CC1(O[C@@H]2C=C(C[C@H]([C@@H]2O1)O)C(=O)O)C

3,4-O-Isopropylidene shikimic acid

CAS: 183075-03-8

Fórmula: C₁₀H₁₄O₅

Pureza: 99.61%

Cor e Forma: Solid

Peso molecular: 214.2152

Ref: IN-DA0024DZ

3,4-O-Isopropylidene-shikimic acid

CAS: 183075-03-8

3,4-O-Isopropylidene-shikimic acid

Fórmula: C₁₀H₁₄O₅

Pureza: ≥98%

Peso molecular: 214.22

Ref: 54-BUP07205

3,4-O-Isopropylidene shikimic acid

CAS: 183075-03-8

Fórmula: C₁₀H₁₄O₅

Peso molecular: 214.22

Ref: 7W-GY5872

3,4-O-Isopropylidene shikimic acid

CAS: 183075-03-8

Fórmula: C₁₀H₁₄O₅

Pureza: 95%~99%

Peso molecular: 214.217

Ref: BP-SBP01077

3,4-O-Isopropylidene-shikimic acid

CAS: 183075-03-8

3,4-O-Isopropylidene-shikimic acid (3,4-O-Isopropylidene shikimic acid) has significant anti-inflammatory, anti-thrombosis, antioxidant, analgesic effects, it

Fórmula: C₁₀H₁₄O₅

Pureza: 99.61%

Cor e Forma: Solid

Peso molecular: 214.22

Ref: TM-TN1238

3,4-o-Isopropylidene shikimic acid

CAS: 183075-03-8

3,4-o-Isopropylidene shikimic acid is a chemical compound classified as a derivative of shikimic acid. It is derived from natural sources, primarily obtained from plants, with shikimic acid often extracted from the star anise tree. The mode of action involves serving as a versatile intermediate in the synthesis of numerous organic compounds. Its acetone-protected configuration enhances stability and reactivity, making it an invaluable tool in organic synthesis.

Fórmula: C₁₀H₁₄O₅

Pureza: Min. 95%

Peso molecular: 214.21 g/mol

Ref: 3D-IHA07503