CAS 248260-75-5

Fórmula: C27H23ClFNO4

InChI: InChI=1S/C27H23FNO4.ClH/c1-30-23-8-7-18-20(11-17-5-3-4-6-22(17)28)26-19-13-25-24(32-15-33-25)12-16(19)9-10-29(26)14-21(18)27(23)31-2;/h3-8,12-14H,9-11,15H2,1-2H3;1H/q+1;/p-1

Chave InChI: RPHFGOXVJGNJJH-UHFFFAOYSA-M

SMILES: COC1=C(C2=C[N+]3=C(C4=CC5=C(C=C4CC3)OCO5)C(=C2C=C1)CC6=CC=CC=C6F)OC.[Cl-]

13-[(2-Fluorophenyl)methyl]-5,6-dihydro-9,10-dimethoxy-benzo[g]-1,3-benzodioxolo[5,6-a]quinolizinium chloride

CAS: 248260-75-5

13-[(2-Fluorophenyl)methyl]-5,6-dihydro-9,10-dimethoxy-benzo[g]-1,3-benzodioxolo[5,6-a]quinolizinium chloride is a synthetic heterocyclic compound, which is a derivative of quinolizinium chloride. It is synthesized through a series of chemical reactions involving arylation and cyclization, leveraging fluorinated aromatic substrates as precursors. The mode of action of this compound typically involves interactions with nucleic acids or enzyme systems, making it a potential candidate for studying biological pathways and molecular interactions.

Fórmula: C₂₇H₂₃FClNO₄

Pureza: Min. 95%

Peso molecular: 479.93 g/mol

Ref: 3D-YJA26075

KRN2

CAS: 248260-75-5

KRN2, an NFAT5 inhibitor with a 100 nM IC50, may treat Chronic Arthritis.

Fórmula: C₂₇H₂₃ClFNO₄

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 479.93

Ref: TM-T11781

KRN2 

CAS: 248260-75-5

Fórmula: C₂₇H₂₃ClFNO₄

Pureza: 98%

Peso molecular: 479.9272

Ref: IN-DA01EO3N