CAS 285978-27-0

Fórmula: C4H6N2

InChI: InChI=1S/C4H6N2/c1-6-3-2-5-4-6/h2-4H,1H3/i1D3,2D,3D,4D

Chave InChI: MCTWTZJPVLRJOU-RLTMCGQMSA-N

SMILES: [2H]C1=C(N(C(=N1)[2H])C([2H])([2H])[2H])[2H]

1-Methylimidazole-d6

CAS: 285978-27-0

1-Methylimidazole-d6

Fórmula: C₄D₆N₂

Peso molecular: 88.14

Ref: 54-DE2691

1-Methylimidazole-d6

CAS: 285978-27-0, 616-47-7

Pureza: 98 atom % D

Cor e Forma: Colorless Liquid

Peso molecular: 88.14

Ref: 3U-D6926

1-Methylimidazole-d6 in Methanol

CAS: 285978-27-0

Methanol

Fórmula: C₄H₆N₂

Peso molecular: 88.14

Ref: BE-BePure-24049XM-100

1-Methylimidazole-d6

Produto Controlado

CAS: 285978-27-0

Applications 1-Methylimidazole-d6 (CAS# 285978-27-0) is a useful isotopically labeled research compound.

Fórmula: C₄D₆N₂

Cor e Forma: Neat

Peso molecular: 88.1408

Ref: TR-M312989

1-Methylimidazole-D6

CAS: 285978-27-0

1-Methylimidazole-d6 is an isotopically labeled compound that is used as an internal standard in quantitative analysis. It is used to quantify the amount of a molecule by comparing its mass to the mass of 1-methylimidazole-d6. The molecular weight of 1-methylimidazole-d6 is 176.068 g/mol and the molecular weight of the molecule being quantified is unknown. The molecular weight can be determined by comparing the relative abundance of 1-methylimidazole-d6 to a known standard such as deuterated water or methanol, which has a molecular weight of 18.015 g/mol.

Fórmula: C₄D₆N₂

Pureza: Min. 95%

Cor e Forma: Clear Liquid

Peso molecular: 88.14 g/mol

Ref: 3D-FM179985