CAS 32362-99-5

Fórmula: C9H10OS

InChI: InChI=1S/C9H10OS/c1-8(10)11-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3

Chave InChI: XQLIUJWBXPIGCB-UHFFFAOYSA-N

SMILES: CC(=O)SCC1=CC=CC=C1

Benzyl thioacetate

CAS: 32362-99-5

Benzyl thioacetate is a chemical inhibitor of the enzyme cytosolic acetaldehyde-oxidoreductase. It also has been shown to inhibit the synthesis of diallyl trisulfide, amide, and hydroxyl group. The reactive functional group in benzyl thioacetate is a carbonyl group, which reacts with the nucleophilic amino acid cysteine to form a covalent adduct. This reaction causes a change in the charge on the molecule as well as an increase in its pKa, which makes it more reactive. Benzyl thioacetate is also known to react with nitro groups and hydroxy groups, making it an excellent candidate for cationic polymerization reactions.

Fórmula: C₉H₁₀OS

Pureza: Min. 95%

Peso molecular: 166.24 g/mol

Ref: 3D-HBA36299