CAS 32431-30-4

Fórmula: C10H6ClNO3

InChI: InChI=1S/C10H6ClNO3/c11-5-1-2-8-6(3-5)7(10(14)15)4-9(13)12-8/h1-4H,(H,12,13)(H,14,15)

Chave InChI: AMYRRFUUZGORKF-UHFFFAOYSA-N

SMILES: C1=CC2=C(C=C1Cl)C(=CC(=O)N2)C(=O)O

6-Chloro-2-oxo-1,2-dihydroquinoline-4-carboxylic acid

CAS: 32431-30-4

6-Chloro-2-oxo-1,2-dihydroquinoline-4-carboxylic acid

Fórmula: C₁₀H₆ClNO₃

Pureza: 95%

Peso molecular: 223.62

Ref: 54-OR1052574

6-Chloro-2-oxo-1,2-dihydroquinoline-4-carboxylic acid

CAS: 32431-30-4

Fórmula: C₁₀H₆ClNO₃

Pureza: 95%

Peso molecular: 223.6125

Ref: IN-DA00I655

6-Chloro-2-oxo-1,2-dihydroquinoline-4-carboxylic acid

CAS: 32431-30-4

6-Chloro-2-oxo-1,2-dihydroquinoline-4-carboxylic acid (6ClOQ) is a molecule that is used as a diagnostic agent and biodegradable drug. It has high affinity binding with target tissues, such as the liver and kidney. 6ClOQ also has potential as an anticancer drug, which may be due to its ability to inhibit DNA synthesis by interacting with hydroxyl groups. 6ClOQ can be conjugated with different molecules, such as monoclonal antibodies, and this characteristic can be used to increase its efficacy in targeting cancer cells. The conjugation of 6ClOQ to a monoclonal antibody increases the stability of the drug and decreases its toxicity.

Fórmula: C₁₀H₆ClNO₃

Pureza: Min. 95%

Peso molecular: 223.61 g/mol

Ref: 3D-HBA43130