CAS 324737-10-2

Fórmula: C9H10N2O3

InChI: InChI=1S/C9H10N2O3/c1-6(9(13)14-2)8(12)7-5-10-3-4-11-7/h3-6H,1-2H3

Chave InChI: TVMXIGKZHSBQIP-UHFFFAOYSA-N

SMILES: CC(C(=O)C1=NC=CN=C1)C(=O)OC

methyl 2-methyl-3-oxo-3-(pyrazin-2-yl)propanoate

CAS: 324737-10-2

Fórmula: C₉H₁₀N₂O₃

Peso molecular: 194.1873

Ref: IN-DA00CKW1

Methyl 2-methyl-3-(pyrazin-2-yl)-3-oxopropionate

CAS: 324737-10-2

Methyl 2-methyl-3-(pyrazin-2-yl)-3-oxopropionate

Fórmula: C₉H₁₀N₂O₃

Pureza: ≥95%

Peso molecular: 194.1873

Ref: 54-OR310604

Methyl 2-methyl-3-oxo-3-(pyrazin-2-yl)propanoate

CAS: 324737-10-2

Methyl 2-methyl-3-oxo-3-(pyrazin-2-yl)propanoate is a versatile compound with various applications. It can be used as a hydroxide solution in research chemicals, and it is commonly used in the synthesis of dimethylnaphthalene, molybdenum, memantine, and other compounds. This chemical can also be used as part of eutectic solvents or to produce phytoestrogens like secoisolariciresinol. Additionally, it has cholinergic properties and can be utilized in the development of drugs such as sphingosine or butorphanol. Moreover, this compound has photocatalytic capabilities and can be employed in processes involving ketamine or zearalenone. Lastly, it plays a role in fatty acid metabolism. With its diverse range of applications, Methyl 2-methyl-3-oxo-3-(pyrazin-

Fórmula: C₉H₁₀N₂O₃

Pureza: Min. 95%

Peso molecular: 194.19 g/mol

Ref: 3D-ZMA73710