CAS 32660-24-5

Fórmula: C34H28FeO2P2

InChI: InChI=1S/2C17H14OP.Fe/c2*18-19(17-13-7-8-14-17,15-9-3-1-4-10-15)16-11-5-2-6-12-16;/h2*1-14H;/q2*-1;+2

Chave InChI: CSCOLJZENYWZRC-UHFFFAOYSA-N

SMILES: [CH-]1C=CC=C1P(=O)(C2=CC=CC=C2)C3=CC=CC=C3.[CH-]1C=CC=C1P(=O)(C2=CC=CC=C2)C3=CC=CC=C3.[Fe+2]

1,1'-Bis(diphenylphosphino)ferrocene dioxide

CAS: 32660-24-5

1,1'-Bis(diphenylphosphino)ferrocene dioxide

Fórmula: C₃₄H₂₈FeO₂P₂

Pureza: 97%

Cor e Forma: Solid

Peso molecular: 586.38

Ref: 54-IN12541

1-methyl-7-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline

CAS: 32660-24-5

Fórmula: C₃₄H₂₈FeO₂P₂

Pureza: 97%

Cor e Forma: Solid

Peso molecular: 586.3774

Ref: IN-DA01KBQL

1,1'-Bis(diphenylphosphino)ferrocene dioxide

CAS: 32660-24-5

Fórmula: C₃₄H₂₈FeO₂P₂

Peso molecular: 586.39

Ref: 4Z-F-169002

1,1'-Bis(diphenylphosphino)ferrocene oxide

CAS: 32660-24-5

1,1'-Bis(diphenylphosphino)ferrocene oxide

Fórmula: C₃₄H₂₈FeO₂P₂

Pureza: 98%

Peso molecular: 586.38

Ref: IN-DG01178340

1,1'-Bis(diphenylphosphino)ferrocene Dioxide

Produto Controlado

CAS: 32660-24-5

Applications 1,1'-Bis(diphenylphosphino)ferrocene Dioxide is a coordination compound used to complex with various metals and form reagents to be used as catalysts in coupling reactions.
References Aikawa, K. et al.: Org. Lett., 18, 3690 (2016);

Fórmula: C₃₄H₂₈FeO₂P₂

Cor e Forma: Neat

Peso molecular: 586.39

Ref: TR-B403965