CAS 34211-53-5

Fórmula: C14H10O6

InChI: InChI=1S/C14H10O6/c1-19-14-8(16)5-9-10(12(14)18)11(17)6-3-2-4-7(15)13(6)20-9/h2-5,15-16,18H,1H3

Chave InChI: JAOZFCHZESUBKS-UHFFFAOYSA-N

SMILES: COC1=C(C2=C(C=C1O)OC3=C(C2=O)C=CC=C3O)O

Tovopyrifolin C

CAS: 34211-53-5

Tovopyrifolin C

Fórmula: C₁₄H₁₀O₆

Pureza: ≥95%

Peso molecular: 274.23

Ref: 54-BUP22071

Tovopyrifolin C

CAS: 34211-53-5

Tovopyrifolin C is a naturally occurring flavonoid found in a variety of plants that inhibits monoamine oxidase (IC50=2.7 µM).

Fórmula: C₁₄H₁₀O₆

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 274.23

Ref: TM-TN5157

Tovopyrifolin C

CAS: 34211-53-5

Fórmula: C₁₄H₁₀O₆

Pureza: 95%~99%

Peso molecular: 274.228

Ref: BP-SBP04172

Tovopyrifolin C

CAS: 34211-53-5

Tovopyrifolin C is a natural bioactive compound, which is derived from the leaves of the plant *Ailanthus altissima*. It is an anthraquinone derivative, known for its complex structure and potential biological activities. This compound is noted for its ability to interact with cellular pathways, primarily through modulation of signal transduction processes. The mode of action involves the interference with cell proliferation and induction of apoptosis, making it a subject of interest in cancer research.

Fórmula: C₁₄H₁₀O₆

Pureza: Min. 95%

Peso molecular: 274.22 g/mol

Ref: 3D-JBA21153