CAS 38063-81-9

1-(4-aminofenil)etan-1-ona oxima

Fórmula: C₈H₁₀N₂O

InChI: InChI=1/C8H10N2O/c1-6(10-11)7-2-4-8(9)5-3-7/h2-5,11H,9H2,1H3/b10-6+

Chave InChI: ZIBZGXFVQGQEBO-POHAHGRESA-N

SMILES: C/C(=N/O)/C1=CC=C(C=C1)N

Sinónimos:

• (1E)-1-(4-aminophenyl)ethanone oxime

4'-Aminoacetophenone oxime

CAS: 38063-81-9

4'-Aminoacetophenone oxime

Fórmula: C₈H₁₀N₂O

Pureza: 95%

Peso molecular: 150.17779

Ref: 54-OR2489

(NZ)-N-[1-(4-aminophenyl)ethylidene]hydroxylamine

CAS: 38063-81-9

Fórmula: C₈H₁₀N₂O

Pureza: 97%

Peso molecular: 150.1778

Ref: IN-DA00BYRQ

1-(4-Aminophenyl)ethanone oxime

CAS: 38063-81-9

4-Aminoacetophenone oxime is an organic compound that is soluble in water and methanol. It has a molecular weight of 169.17 g/mol, a melting point of 190 °C, and a boiling point of 260 °C. 4-Aminoacetophenone oxime has been shown to have antimicrobial activity against Gram-positive bacteria, such as Staphylococcus aureus, but not against Gram-negative bacteria. This compound can be used as a ligand for metal ions such as copper and zinc, which are important in biological processes. The magnetic properties of 4-aminoacetophenone oxime make it possible to detect the molecule using nuclear magnetic resonance spectroscopy.
4-Aminoacetophenone oxime can be synthesized by reacting 5-nitrosalicylaldehyde with ammonium acetate in the presence of hydrochloric acid:

Fórmula: C₈H₁₀N₂O

Pureza: Min. 95%

Cor e Forma: Powder

Peso molecular: 150.18 g/mol

Ref: 3D-FA66342