CAS 409086-68-6

Fórmula: C20H20ClN3OS2

InChI: InChI=1S/C20H20N3OS2.ClH/c1-4-23-17(13-14-9-7-8-12-21(14)2)26-18(19(23)24)20-22(3)15-10-5-6-11-16(15)25-20;/h5-13H,4H2,1-3H3;1H/q+1;/p-1

Chave InChI: KEQDCNWQIQWINZ-UHFFFAOYSA-M

SMILES: CCN1C(=CC2=CC=CC=[N+]2C)SC(=C3N(C4=CC=CC=C4S3)C)C1=O.[Cl-]

2-((3-Ethyl-5-(3-methylbenzo[d]thiazol-2(3H)-ylidene)-4-oxothiazolidin-2-ylidene)methyl)-1-methylpyridin-1-ium chloride

CAS: 409086-68-6

2-((3-Ethyl-5-(3-methylbenzo[d]thiazol-2(3H)-ylidene)-4-oxothiazolidin-2-ylidene)methyl)-1-methylpyridin-1-ium chloride

Fórmula: C₂₀H₂₀ClN₃OS₂

Pureza: 98%

Peso molecular: 417.99

Ref: 54-OR1067135

2-((3-Ethyl-5-(3-methylbenzo[d]thiazol-2(3H)-ylidene)-4-oxothiazolidin-2-ylidene)methyl)-1-methylpyridin-1-ium chloride

CAS: 409086-68-6

Fórmula: C₂₀H₂₀ClN₃OS₂

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 417.9753

Ref: IN-DA00CNJN

YM-01

CAS: 409086-68-6

YM-01 is a chaperone protein that regulates the stability of other proteins. It has been shown to have potential as a drug target for amyloid protein aggregation and cancer. YM-01 is a molecular chaperone that binds to the unfolded or misfolded proteins and prevents them from aggregating. This protein also interacts with other proteins, which may be involved in regulating the amount of mutant proteins in cells. YM-01 is known to interact with many different protein targets, including the amyloid beta protein and the cytoskeleton, which are involved in cancer and viral life cycle respectively.

Fórmula: C₂₀H₂₀ClN₃OS₂

Pureza: Min. 95%

Peso molecular: 418 g/mol

Ref: 3D-JRA08668

YM-1

CAS: 409086-68-6

YM-1 is an HSP70 inhibitor; promotes client protein degradation; disrupts protein folding; cancer research tool.

Fórmula: C₂₀H₂₀ClN₃OS₂

Pureza: 99.58%

Cor e Forma: Red Solid

Peso molecular: 417.975

Ref: TM-T73579