CAS 480452-37-7

Fórmula: C16H22ClN5O3

InChI: InChI=1S/C16H22ClN5O3/c1-22(2)16(25)9-3-5-12(11(18)7-9)20-14(23)15(24)21-13-6-4-10(17)8-19-13/h4,6,8-9,11-12H,3,5,7,18H2,1-2H3,(H,20,23)(H,19,21,24)/t9-,11+,12-/m0/s1

Chave InChI: IZABLUDXAWYTNU-WCQGTBRESA-N

SMILES: CN(C)C(=O)[C@H]1CC[C@@H]([C@@H](C1)N)NC(=O)C(=O)NC2=NC=C(C=C2)Cl

Edoxaban impurity 6

CAS: 480452-37-7

Edoxaban impurity 6

Pureza: ≥95%

Ref: 54-OR1040349

Edoxaban impurity 6

CAS: 480452-37-7

Edoxaban impurity 6 is a byproduct of the anticoagulant Edoxaban, a potent oral factor Xa inhibitor with Kis of 0.561 nM. Used to prevent stroke.

Fórmula: C₁₆H₂₂ClN₅O₃

Cor e Forma: Solid

Peso molecular: 367.83

Ref: TM-T37176

N1-[(1S,2R,4S)-2-Amino-4-[(dimethylamino)carbonyl]cyclohexyl]-N2-(5-chloro-2-pyridinyl)ethanediamide

CAS: 480452-37-7

Fórmula: C₁₆H₂₂ClN₅O₃

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 367.8306

Ref: IN-DA00DKIT

EthanediaMide iMpurity F

CAS: 480452-37-7

N1-((1S,2R,4S)-2-Amino-4-(dimethylcarbamoyl)cyclohexyl)-N2-(5-chloropyridin-2-yl)oxalamide

Fórmula: C₁₆H₂₂ClN₅O₃

Pureza: 95%

Peso molecular: 367.83

Ref: IN-DG00950914

N1-((1S,2R,4S)-2-AMINO-4-(DIMETHYLCARBAMOYL)CYCLOHEXYL)-N2-(5-CHLOROPYRIDIN-2-YL)OXALAMIDE

CAS: 480452-37-7

Pureza: 98%

Peso molecular: 367.8299866

Ref: 10-F816196

N-[(1S,2R,4S)-2-Amino-4-(dimethylcarbamoyl)cyclohexyl]-N'-(5-chloropyridin-2-yl)oxamide

CAS: 480452-37-7

N-[(1S,2R,4S)-2-Amino-4-(dimethylcarbamoyl)cyclohexyl]-N'-(5-chloropyridin-2-yl)oxamide is a synthetic compound, which is an engineered chemical structure with potential pharmacological properties. This compound is sourced from systematic organic synthesis, employing targeted molecular adjustments to achieve a precise configuration that may interact with specific biological pathways. It operates by potentially modulating receptor activity or enzyme inhibition, although detailed mechanistic studies are necessary to fully elucidate its mode of action. Its unique configuration allows it to possibly interact with certain biomolecules, aiming to alter or inhibit pathological processes.

Fórmula: C₁₆H₂₂ClN₅O₃

Pureza: 95%Nmr

Peso molecular: 367.8 g/mol

Ref: 3D-FUA45237