CAS 50376-43-7

Fórmula: C27H32O14

InChI: InChI=1S/C27H32O14/c1-11-20(33)22(35)24(37)26(38-11)41-25-23(36)21(34)18(10-28)40-27(25)39-14-8-16(31)19(17(32)9-14)15(30)7-4-12-2-5-13(29)6-3-12/h2-9,11,18,20-29,31-37H,10H2,1H3/b7-4+/t11-,18+,20-,21+,22+,23-,24+,25+,26-,27+/m0/s1

Chave InChI: IXVXIWLKOMVSFY-GOZPEMRWSA-N

SMILES: C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC3=CC(=C(C(=C3)O)C(=O)/C=C/C4=CC=C(C=C4)O)O)CO)O)O)O)O)O

Naringin chalcone

CAS: 50376-43-7

Naringin chalcone is a flavonoid derivative, which is a naturally occurring compound primarily found in citrus fruits, especially grapefruits. It is derived from naringin, a flavanone glycoside, through a series of bioconversion or chemical synthesis processes. The compound acts through various biochemical pathways, primarily exhibiting antioxidant and anti-inflammatory properties. Its antioxidant action involves scavenging free radicals and upregulating the body's endogenous defense systems, thus reducing oxidative stress. Additionally, it modulates inflammatory responses by inhibiting specific signaling pathways that lead to the production of pro-inflammatory cytokines.

Fórmula: C₂₇H₃₂O₁₄

Pureza: Min. 95%

Cor e Forma: Powder

Peso molecular: 580.53 g/mol

Ref: 3D-FN65312