CAS 5942-25-6

Fórmula: C10H13NO4

InChI: InChI=1S/C10H13NO4/c1-15-9-6-7(2-3-8(9)13)10(14)11-4-5-12/h2-3,6,12-13H,4-5H2,1H3,(H,11,14)

Chave InChI: JDMYVMZSGKUWLR-UHFFFAOYSA-N

SMILES: COC1=C(C=CC(=C1)C(=O)NCCO)O

Bryonamide B

CAS: 5942-25-6

Bryonamide B

Fórmula: C₁₀H₁₃NO₄

Pureza: ≥98%

Peso molecular: 211.21

Ref: 54-BUP07323

Bryonamide B

CAS: 5942-25-6

Fórmula: C₁₀H₁₃NO₄

Peso molecular: 211.22

Ref: 7W-GY3900

Bryonamide B

CAS: 5942-25-6

Bryonamide B is a cucurbitane triterpene that can be extracted from Bryonia aspera.

Fórmula: C₁₀H₁₃NO₄

Pureza: 99.97%

Cor e Forma: White Solid

Peso molecular: 211.2145

Ref: TM-TN1457

Bryonamide B

CAS: 5942-25-6

Fórmula: C₁₀H₁₃NO₄

Pureza: 95%~99%

Peso molecular: 211.217

Ref: BP-BP4418

Bryonamide B

CAS: 5942-25-6

Ref: IN-DA01V38F

Bryonamide B

CAS: 5942-25-6

Bryonamide B is a cyclic peptide that acts as a cytotoxic compound, which is derived from marine cyanobacteria, specifically within the order Nostocales. This compound is produced through the secondary metabolic processes of these microorganisms, highlighting its natural origin and the complex biosynthesis pathways involved. Marine cyanobacteria are renowned for their ability to produce a plethora of bioactive substances with diverse biological activities.

Fórmula: C₁₀H₁₃NO₄

Pureza: Min. 95%

Peso molecular: 211.21 g/mol

Ref: 3D-FAA94225