CAS 6199-67-3
:(+)-Cucurbitacina B
Fórmula:C32H46O8
InChI:InChI=1S/C32H46O8/c1-17(33)40-27(2,3)13-12-23(36)32(9,39)25-21(35)15-29(6)22-11-10-18-19(14-20(34)26(38)28(18,4)5)31(22,8)24(37)16-30(25,29)7/h10,12-13,19-22,25,34-35,39H,11,14-16H2,1-9H3/b13-12+/t19-,20+,21-,22+,25+,29+,30-,31+,32+/m1/s1
Chave InChI:InChIKey=IXQKXEUSCPEQRD-DKRGWESNSA-N
SMILES:C[C@]12[C@@](C)([C@@]([C@@](C(/C=C/C(OC(C)=O)(C)C)=O)(C)O)([C@H](O)C1)[H])CC(=O)[C@]3(C)[C@]2(CC=C4[C@]3(C[C@H](O)C(=O)C4(C)C)[H])[H]
Sinónimos:- (23E)-2,16,20-trihydroxy-9,10,14-trimethyl-1,11,22-trioxo-4,9-cyclo-9,10-secocholesta-5,23-dien-25-yl acetate
- (2S,4R,9beta,16alpha)-2,16,20-trihydroxy-9,10,14-trimethyl-1,11,22-trioxo-4,9-cyclo-9,10-secocholesta-5,23-dien-25-yl acetate
- (2S,4R,9beta,16alpha,17xi,23E)-2,16,20-trihydroxy-9,10,14-trimethyl-1,11,22-trioxo-4,9-cyclo-9,10-secocholesta-5,23-dien-25-yl acetate
- (2S,4R,9beta,16alpha,23E)-2,16,20-trihydroxy-9,10,14-trimethyl-1,11,22-trioxo-4,9-cyclo-9,10-secocholesta-5,23-dien-25-yl acetate
- (2β,9β,10α,16α,23E)-25-(Acetyloxy)-2,16,20-trihydroxy-9-methyl-19-norlanosta-5,23-diene-3,11,22-trione
- 19-Nor-9β,10α-lanosta-5,23-diene-3,11,22-trione, 2β,16α,20,25-tetrahydroxy-9-methyl-, 25-acetate
- 19-Norlanosta-5,23-diene-3,11,22-trione, 25-(acetyloxy)-2,16,20-trihydroxy-9-methyl-, (2β,9β,10α,16α,23E)-
- Amarine
- Cucurbitacine B
- Hy-N 0416
- NSC 144154
- NSC 49451
- Ver mais sinónimos
Ordenar por
Pureza (%)
0
100
|
0
|
50
|
90
|
95
|
100
Foram encontrados 10 produtos.
Cucurbitacin B
CAS:Fórmula:C32H46O8Pureza:>98.0%(HPLC)Cor e Forma:White to Light yellow powder to crystalPeso molecular:558.71Cucurbitacin B
CAS:Cucurbitacin B analytical standard provided with w/w absolute assay, to be used for quantitative titration.Fórmula:C32H46O8Pureza:(HPLC) ≥95%Cor e Forma:PowderPeso molecular:558.72Cucurbitacin B
CAS:Cucurbitacin B (cucB) is a triterpenoid constituent of Cucurbitaceae vegetables and a promising phytochemical for cancer prevention, cucB induces G(2) arrest and apoptosis through a STAT3-independent but ROS-dependent mechanism in SW480 cells.Fórmula:C32H46O8Pureza:95%~99%Cor e Forma:White powderPeso molecular:558.712Cucurbitacin B
CAS:Cucurbitacin B (Cuc B) has profound in vitro and in vivo antiproliferative effects against human pancreatic Y cells.Fórmula:C32H46O8Pureza:97.1% - 99.93%Cor e Forma:SolidPeso molecular:558.70Cucurbitacin B
CAS:Fórmula:C32H46O8Pureza:≥ 98.0%Cor e Forma:White to off-white powderPeso molecular:558.71Cucurbitacin B
CAS:Carboxylic acid with additional oxygen functionsFórmula:C32H46O8Pureza:≥ 90.0 % (HPLC)Cor e Forma:PowderPeso molecular:558.71Cucurbitacin B
CAS:Produto ControladoCucurbitacin B is a triterpenoid compound, which is derived from plants primarily within the Cucurbitaceae family. This compound exhibits its mode of action through the inhibition of the JAK-STAT signaling pathway, effectively disrupting processes that are critical for cell survival and proliferation. As a result, Cucurbitacin B is being extensively studied for its antiproliferative and pro-apoptotic properties, especially in the context of cancer research.Fórmula:C32H46O8Pureza:Min. 95%Cor e Forma:White PowderPeso molecular:558.7 g/molCucurbitacin B
CAS:Produto ControladoApplications Cucurbitacin B is a tetracyclic triterpenoid, which can induce apoptosis in human hepatoma cells. It can also induce DNA damage and autophagy in MCF-7 breast cancer cells.In the wild, watermelons, cucumbers, and muskmelons produce bitter Cucurbitacins to defend against preditors. Humans have bred these fruits to eliminate these compounds thereby yielding fruits that are more appealing to our palate.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Sun, Y., et al.: Eur. J. Pharmacol. 768, 28 (2015); Ren, G., et al.: J. Nat. Med. 69, 522 (2015); C&E News p. 10, Dec. 5, 2016jFórmula:C32H46O8Cor e Forma:NeatPeso molecular:558.7









