CAS 63068-73-5

Fórmula: C8H10O2S

InChI: InChI=1S/C8H10O2S/c1-2-3-6-4-5-7(11-6)8(9)10/h4-5H,2-3H2,1H3,(H,9,10)

Chave InChI: GIKRNWSWBGWABK-UHFFFAOYSA-N

SMILES: CCCC1=CC=C(S1)C(=O)O

5-Propylthiophene-2-carboxylic acid

CAS: 63068-73-5

Fórmula: C₈H₁₀O₂S

Pureza: 95%

Cor e Forma: Solid

Peso molecular: 170.2288

Ref: IN-DA00EA5E

5-Propylthiophene-2-carboxylic acid

CAS: 63068-73-5

5-Propylthiophene-2-carboxylic acid

Fórmula: C₈H₁₀O₂S

Peso molecular: 170.23

Ref: 54-OR1093220

5-propylthiophene-2-carboxylic acid

CAS: 63068-73-5

Fórmula: C₈H₁₀O₂S

Pureza: ≥95%

Peso molecular: 170.23

Ref: 10-F425861

5-Propylthiophene-2-carboxylic Acid

Produto Controlado

CAS: 63068-73-5

Fórmula: C₈H₁₀O₂S

Cor e Forma: Neat

Peso molecular: 170.229

Ref: TR-P838603

5-Propyl-thiophene-2-carboxylic acid

CAS: 63068-73-5

5-Propyl-thiophene-2-carboxylic acid is a cyclic hydrocarbon that has been synthesized in an asymmetric synthesis. It has a monosubstituted hydrocarbon group and a heterocyclic group. The 5-propyl-thiophene-2-carboxylic acid is a liquid crystal, which means it can form three different phases, including the isotropic phase, the nematic phase, and the smectic phase. 5-Propyl-thiophene-2-carboxylic acid is also a cyclic compound and can be classified as being a heterocyclic.

Fórmula: C₈H₁₀O₂S

Pureza: Min. 95%

Peso molecular: 170.23 g/mol

Ref: 3D-NCA06873