CAS 647853-82-5

Fórmula: C23H26O11

InChI: InChI=1S/C23H26O11/c1-11(25)32-22-21(31)20(30)18(10-24)34-23(22)33-14-8-16(28)19(17(29)9-14)15(27)7-4-12-2-5-13(26)6-3-12/h2-3,5-6,8-9,18,20-24,26,28-31H,4,7,10H2,1H3/t18-,20-,21+,22-,23-/m1/s1

Chave InChI: QIEAJYJXGQAYRU-DODNOZFWSA-N

SMILES: CC(=O)O[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1OC2=CC(=C(C(=C2)O)C(=O)CCC3=CC=C(C=C3)O)O)CO)O)O

Trilobatin 2''-acetate

CAS: 647853-82-5

Trilobatin 2''-acetate is a natural product for research related to life sciences. The catalog number is TN5179 and the CAS number is 647853-82-5.

Fórmula: C₂₃H₂₆O₁₁

Pureza: 98%

Cor e Forma: Solid

Peso molecular: 478.4459

Ref: TM-TN5179

Trilobatin 2''-acetate

CAS: 647853-82-5

Fórmula: C₂₃H₂₆O₁₁

Pureza: 95%~99%

Cor e Forma: Powder

Peso molecular: 478.45

Ref: BP-SBP60031

Trilobatin 2''-acetate

CAS: 647853-82-5

Trilobatin 2''-acetate is a bioactive compound derivative, which is a modified form of the naturally occurring glycoside, trilobatin. This compound is sourced from certain plant species, notably within the Rosaceae family. Trilobatin is primarily extracted from leaves, where it naturally functions as a defense compound and contributes to the plant’s sweetness.

Fórmula: C₂₃H₂₆O₁₁

Pureza: Min. 95%

Peso molecular: 478.4 g/mol

Ref: 3D-XAB85382

Trilobatin 2''-acetate

CAS: 647853-82-5

Fórmula: C₂₃H₂₆O₁₁

Pureza: 98.5%

Peso molecular: 478.4459

Ref: IN-DA00EGWD