CAS 68060-01-5

Fórmula: C8H16O2

InChI: InChI=1S/C8H16O2/c1-3-4-5-6-7-8(9)10-2/h3-7H2,1-2H3/i1D3,3D2,4D2,5D2,6D2,7D2

Chave InChI: XNCNNDVCAUWAIT-IFRPIJOISA-N

SMILES: [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)OC

Methyl heptanoate-d13

CAS: 68060-01-5

Methyl heptanoate-d13 (Methyl enanthate-d13) is the deuterium-labeled form of Methyl heptanoate. Commonly used as a flavor and fragrance ingredient in the food and cosmetic industries, Methyl heptanoate also serves as a solvent for various substances, including resins, oils, and waxes. Additionally, its potential applications in biofuel and polymer production have been studied.

Fórmula: C₈H₁₆O₂

Peso molecular: 157.29

Ref: TM-TMIT-0470

Methyl Heptanoate-d13

CAS: 106-73-0, 68060-01-5

Pureza: 98 atom % D

Peso molecular: 209.5

Ref: 3U-D8303